Difference between revisions of "Ec-06 000970"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Gene == Gene Ec-06_000970 == * left end position: ** 628492 * transcription direction: ** NEGATIVE * right end position: ** 650173 * centisome position: ** 7.1764...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] ==
+
== Gene Ec-06_000970 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 628492
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** ergost-7-enol
+
** 650173
−
* molecular weight:
+
* centisome position:
−
** 400.687    
+
** 7.176403    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0279_0006
 +
** Esi0279_0006
 +
** MTR
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13883]]
+
* Reaction: [[HOMOCYSMET-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[HOMOCYSMETB12-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-3841]]
 +
* [[ADENOSYLHOMOCYSCAT-PWY]]
 +
* [[PWY-702]]
 +
* [[HOMOSER-METSYN-PWY]]
 +
* [[HSERMETANA-PWY]]
 +
* [[PWY-5041]]
 +
* [[PWY-2201]]
 +
* [[1CMET2-PWY]]
 +
* [[PWY-6151]]
 
== External links  ==
 
== External links  ==
−
* CAS : 516-78-9
+
{{#set: left end position=628492}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657800 90657800]
+
{{#set: right end position=650173}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: centisome position=7.176403    }}
−
{{#set: inchi key=InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N}}
+
{{#set: common name=Esi_0279_0006|Esi0279_0006|MTR}}
−
{{#set: common name=ergost-7-enol}}
+
{{#set: reaction associated=HOMOCYSMET-RXN|HOMOCYSMETB12-RXN}}
−
{{#set: molecular weight=400.687    }}
+
{{#set: pathway associated=PWY-3841|ADENOSYLHOMOCYSCAT-PWY|PWY-702|HOMOSER-METSYN-PWY|HSERMETANA-PWY|PWY-5041|PWY-2201|1CMET2-PWY|PWY-6151}}
−
{{#set: consumed by=RXN-13883}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-06_000970

  • left end position:
    • 628492
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 650173
  • centisome position:
    • 7.176403
  • Synonym(s):
    • Esi_0279_0006
    • Esi0279_0006
    • MTR

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_000970&oldid=29503"