Difference between revisions of "CPD-11641"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_000340 == * left end position: ** 230160 * transcription direction: ** POSITIVE * right end position: ** 234228 * centisome position: ** 3.5684...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 4-methylumbelliferyl glucoside |
| − | * | + | * molecular weight: |
| − | ** | + | ** 338.313 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4-MU-glucoside |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-10769]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB02639 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550] |
| − | {{#set: | + | {{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}} |
| + | {{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}} | ||
| + | {{#set: common name=4-methylumbelliferyl glucoside}} | ||
| + | {{#set: molecular weight=338.313 }} | ||
| + | {{#set: common name=4-MU-glucoside}} | ||
| + | {{#set: consumed by=RXN-10769}} | ||
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD-11641
- smiles:
- CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
- inchi key:
- InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
- common name:
- 4-methylumbelliferyl glucoside
- molecular weight:
- 338.313
- Synonym(s):
- 4-MU-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
