Difference between revisions of "PWY-6961"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6961 PWY-6961] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4577 CPD-4577] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6961 PWY-6961] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M
+
 
* common name:
 
* common name:
−
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol
+
** L-ascorbate degradation II (bacterial, aerobic)
−
* molecular weight:
+
−
** 441.673   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol
 
−
** 4β-methylzymosterol-4α-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-313]]
+
'''3''' reactions found over '''8''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-12440]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-02_001210]]
 +
*** [[Ec-19_000230]]
 +
*** [[Ec-02_001740]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12861]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12862]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=LXULRU5P-RXN LXULRU5P-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RIBULPEPIM-RXN RIBULPEPIM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-703 RXN0-703]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-704 RXN0-704]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-705 RXN0-705]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657655 90657655]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6961 PWY-6961]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64925 64925]
+
{{#set: common name=L-ascorbate degradation II (bacterial, aerobic)}}
−
* LIGAND-CPD:
+
{{#set: reaction found=3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15808 C15808]
+
{{#set: total reaction=8}}
−
* HMDB : HMDB06927
+
{{#set: completion rate=38.0}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=MYWAIWDQTCHPTH-LJAIZBFVSA-M}}
+
−
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: molecular weight=441.673    }}
+
−
{{#set: common name=4β-methyl-4α-carboxy-cholesta-8,24-dien-3β-ol|4β-methylzymosterol-4α-carboxylate}}
+
−
{{#set: consumed by=RXN66-313}}
+

Latest revision as of 20:17, 21 March 2018

Pathway PWY-6961

  • taxonomic range:
  • common name:
    • L-ascorbate degradation II (bacterial, aerobic)
  • Synonym(s):

Reaction(s) found

3 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6961&oldid=25838"