Difference between revisions of "Ec-01 002250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Gene == Gene Ec-01_002250 == * left end position: ** 1865477 * transcription direction: ** POSITIVE * right end position: ** 1867893 * centisome position: ** 18.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
+
== Gene Ec-01_002250 ==
−
* smiles:
+
* left end position:
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
+
** 1865477
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
+
** 1867893
−
* molecular weight:
+
* centisome position:
−
** 572.278    
+
** 18.078371    
 
* Synonym(s):
 
* Synonym(s):
−
** iPTP
+
** Esi_0003_0046
−
** isopentenyladenosine riboside-5'-triphosphate
+
** Esi0003_0046
−
** iPRTP
+
−
** isopentenyladenosine-5'-triphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.8.23-RXN]]
−
* [[RXN-4303]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10827]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10828]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6322]]
 +
* [[PWY-7769]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1865477}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1867893}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679]
+
{{#set: centisome position=18.078371   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0003_0046|Esi0003_0046}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424]
+
{{#set: reaction associated=2.7.8.23-RXN|RXN-10827|RXN-10828}}
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}}
+
{{#set: pathway associated=PWY-6322|PWY-7769}}
−
{{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}}
+
−
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
−
{{#set: molecular weight=572.278   }}
+
−
{{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}}
+
−
{{#set: produced by=RXN-4303}}
+

Latest revision as of 19:50, 21 March 2018

Gene Ec-01_002250

  • left end position:
    • 1865477
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1867893
  • centisome position:
    • 18.078371
  • Synonym(s):
    • Esi_0003_0046
    • Esi0003_0046

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_002250&oldid=29677"