Difference between revisions of "OROTATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5260 RXN0-5260] == * direction: ** LEFT-TO-RIGHT * common name: ** sn-glycerol 3-phosphate:ubi...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5260 RXN0-5260] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=C(C([O-])=O)NC(NC(=O)1)=O)
 +
* inchi key:
 +
** InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** sn-glycerol 3-phosphate:ubiquinone oxidoreductase
+
** orotate
−
** glycerol-3-phosphate dehydrogenase
+
* molecular weight:
−
* ec number:
+
** 155.09   
−
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** orotic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-6490]]
−
** 1 [[Ubiquinones]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[Ubiquinols]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN0-6491]]
−
** 1 a ubiquinone[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 glycerone phosphate[c] '''+''' 1 an ubiquinol[c]
+
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
−
 
+
* [[RXN0-6554]]
−
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
−
Genes have been associated with this reaction based on different elements listed below.
+
* [[OROPRIBTRANS-RXN]]
−
* Gene: [[Ec-10_003310]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6118]], glycerol-3-phosphate shuttle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6118 PWY-6118]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY0-1561]], glycerol-3-phosphate to cytochrome bo oxidase electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1561 PWY0-1561]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY0-1584]], nitrate reduction X (periplasmic, dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1584 PWY0-1584]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6952]], glycerophosphodiester degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6952 PWY-6952]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 65-86-1
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28755 28755]
+
* BIGG : 34527
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18977 18977]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1492348 1492348]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00849 R00849]
+
* HMDB : HMDB00226
−
** [http://www.genome.jp/dbget-bin/www_bget?R08657 R08657]
+
* LIGAND-CPD:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00295 C00295]
−
{{#set: common name=sn-glycerol 3-phosphate:ubiquinone oxidoreductase}}
+
* CHEBI:
−
{{#set: common name=glycerol-3-phosphate dehydrogenase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30839 30839]
−
{{#set: ec number=EC-1.1.5.3}}
+
* METABOLIGHTS : MTBLC30839
−
{{#set: gene associated=Ec-10_003310}}
+
{{#set: smiles=C1(=C(C([O-])=O)NC(NC(=O)1)=O)}}
−
{{#set: in pathway=PWY-4261|PWY-6118|PWY0-1561|PWY0-1584|PWY-6952}}
+
{{#set: inchi key=InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=orotate}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: molecular weight=155.09    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=orotic acid}}
 +
{{#set: consumed by=RXN0-6490}}
 +
{{#set: produced by=RXN0-6491|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN0-6554}}
 +
{{#set: reversible reaction associated=OROPRIBTRANS-RXN}}

Latest revision as of 19:50, 21 March 2018

Metabolite OROTATE

  • smiles:
    • C1(=C(C([O-])=O)NC(NC(=O)1)=O)
  • inchi key:
    • InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
  • common name:
    • orotate
  • molecular weight:
    • 155.09
  • Synonym(s):
    • orotic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 65-86-1
  • BIGG : 34527
  • PUBCHEM:
  • HMDB : HMDB00226
  • LIGAND-CPD:
  • CHEBI:
  • METABOLIGHTS : MTBLC30839
"C1(=C(C([O-])=O)NC(NC(=O)1)=O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=OROTATE&oldid=29713"