Difference between revisions of "Ec-01 007760"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O...")
(Created page with "Category:Gene == Gene Ec-01_007760 == * left end position: ** 6629086 * transcription direction: ** POSITIVE * right end position: ** 6632534 * centisome position: ** 64.2...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] ==
+
== Gene Ec-01_007760 ==
−
* smiles:
+
* left end position:
−
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O
+
** 6629086
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA
+
** 6632534
−
* molecular weight:
+
* centisome position:
−
** 863.619    
+
** 64.24259    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-methyl-3-hydroxybutyryl-CoA
+
** Esi_0002_0116
−
** (2S,3S)-3-hydroxy-2-methylbutyryl-CoA
+
** Esi0002_0116
−
** (S)-3-hydroxy-2-methylbutyryl-CoA
+
** putativeMnSOD
−
** 3-hydroxy-2-methylbutyryl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[SUPEROX-DISMUT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
*** Assignment: ec-number
−
* [[1.1.1.178-RXN]]
+
== Pathways associated ==
 +
* [[DETOX1-PWY-1]]
 +
* [[PWY-6854]]
 +
* [[DETOX1-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6629086}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657672 90657672]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6632534}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15449 15449]
+
{{#set: centisome position=64.24259   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0002_0116|Esi0002_0116|putativeMnSOD}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04405 C04405]
+
{{#set: reaction associated=SUPEROX-DISMUT-RXN}}
−
* HMDB : HMDB01356
+
{{#set: pathway associated=DETOX1-PWY-1|PWY-6854|DETOX1-PWY}}
−
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O}}
+
−
{{#set: inchi key=InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J}}
+
−
{{#set: common name=(2S,3S)-3-hydroxy-2-methylbutanoyl-CoA}}
+
−
{{#set: molecular weight=863.619   }}
+
−
{{#set: common name=2-methyl-3-hydroxybutyryl-CoA|(2S,3S)-3-hydroxy-2-methylbutyryl-CoA|(S)-3-hydroxy-2-methylbutyryl-CoA|3-hydroxy-2-methylbutyryl-CoA}}
+
−
{{#set: reversible reaction associated=TIGLYLCOA-HYDROXY-RXN|1.1.1.178-RXN}}
+

Latest revision as of 19:51, 21 March 2018

Gene Ec-01_007760

  • left end position:
    • 6629086
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6632534
  • centisome position:
    • 64.24259
  • Synonym(s):
    • Esi_0002_0116
    • Esi0002_0116
    • putativeMnSOD

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_007760&oldid=29775"