Difference between revisions of "Ec-12 001080"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Gene == Gene Ec-12_001080 == * left end position: ** 1015881 * transcription direction: ** POSITIVE * right end position: ** 1019821 * centisome position: ** 12.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_001080 == |
− | * | + | * left end position: |
− | ** | + | ** 1015881 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1019821 |
− | * | + | * centisome position: |
− | ** | + | ** 12.186597 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0193_0066 |
+ | ** Esi0193_0066 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=1015881}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1019821}} | |
− | + | {{#set: centisome position=12.186597 }} | |
− | + | {{#set: common name=Esi_0193_0066|Esi0193_0066}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:51, 21 March 2018
Gene Ec-12_001080
- left end position:
- 1015881
- transcription direction:
- POSITIVE
- right end position:
- 1019821
- centisome position:
- 12.186597
- Synonym(s):
- Esi_0193_0066
- Esi0193_0066
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome