Difference between revisions of "CPD-397"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8450 RXN-8450] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8450 RXN-8450] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C[S+](CCC([N+])C(=O)[O-])C
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.14.11.23 EC-1.14.11.23]
+
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
 +
* common name:
 +
** S-methyl-L-methionine
 +
* molecular weight:
 +
** 164.242   
 
* Synonym(s):
 
* Synonym(s):
 +
** S-methylmethionine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[MMUM-RXN]]
−
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-7087]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[MYRICETIN]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 2-oxoglutarate[c] '''+''' 1 (+)-dihydromyricetin[c] '''+''' 1 oxygen[c] '''=>''' 1 H2O[c] '''+''' 1 myricetin[c] '''+''' 1 CO2[c] '''+''' 1 succinate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-19_002760]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-08_003510]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-19_002750]]
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-5391]], syringetin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5391 PWY-5391]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06539 R06539]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-1.14.11.23}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
−
{{#set: gene associated=Ec-19_002760|Ec-08_003510|Ec-19_002750}}
+
* BIGG : 41336
−
{{#set: in pathway=PWY-3101|PWY-5391}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
−
{{#set: reconstruction source=orthology-aragem}}
+
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
 +
{{#set: common name=S-methyl-L-methionine}}
 +
{{#set: molecular weight=164.242    }}
 +
{{#set: common name=S-methylmethionine}}
 +
{{#set: consumed by=MMUM-RXN}}

Latest revision as of 19:51, 21 March 2018

Metabolite CPD-397

  • smiles:
    • C[S+](CCC([N+])C(=O)[O-])C
  • inchi key:
    • InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
  • common name:
    • S-methyl-L-methionine
  • molecular weight:
    • 164.242
  • Synonym(s):
    • S-methylmethionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-397&oldid=29827"