Difference between revisions of "RXN-7922"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * smiles: ** COC1(C=C(C=CCO)C=C(OC)C(O)=1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7922 RXN-7922] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7922 RXN-7922] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.14.11.9 EC-1.14.11.9] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-7214]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-7087]][c] '''+''' 1 [[SUC]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''+''' 1 (2S)-dihydrotricetin[c] '''=>''' 1 CO2[c] '''+''' 1 (+)-dihydromyricetin[c] '''+''' 1 succinate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-19_002760]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | * Gene: [[Ec-08_003510]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | * Gene: [[Ec-19_002750]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5152]], leucodelphinidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5152 PWY-5152] | ||
| + | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05039 R05039] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | * LIGAND- | + | {{#set: ec number=EC-1.14.11.9}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-19_002760|Ec-08_003510|Ec-19_002750}} |
| − | + | {{#set: in pathway=PWY-5152}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-aragem}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:52, 21 March 2018
Contents
Reaction RXN-7922
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-KETOGLUTARATE[c] + 1 OXYGEN-MOLECULE[c] + 1 CPD-7214[c] => 1 CARBON-DIOXIDE[c] + 1 CPD-7087[c] + 1 SUC[c]
- With common name(s):
- 1 2-oxoglutarate[c] + 1 oxygen[c] + 1 (2S)-dihydrotricetin[c] => 1 CO2[c] + 1 (+)-dihydromyricetin[c] + 1 succinate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-19_002760
- Source: orthology-aragem
- Gene: Ec-08_003510
- Source: orthology-aragem
- Gene: Ec-19_002750
- Source: orthology-aragem
Pathways
- PWY-5152, leucodelphinidin biosynthesis: PWY-5152
- 2 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- LIGAND-RXN:
