Difference between revisions of "RXNQT-4142"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4142 RXNQT-4142] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4142 RXNQT-4142] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
+
** [http://enzyme.expasy.org/EC/3.1.3.93 EC-3.1.3.93]
−
* common name:
+
−
** XTP
+
−
* molecular weight:
+
−
** 520.136   
+
 
* Synonym(s):
 
* Synonym(s):
−
** xanthosine 5' triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-1603]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPDQT-4]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-Galactopyranose]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 β-L-galactose 1-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 L-galactopyranose[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_004120]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882]
 +
** '''7''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26349 26349]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07674 R07674]
−
* BIGG : 35735
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.1.3.93}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
+
{{#set: gene associated=Ec-21_004120}}
−
* HMDB : HMDB00293
+
{{#set: in pathway=PWY-882}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: common name=XTP}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=520.136    }}
+
−
{{#set: common name=xanthosine 5' triphosphate}}
+
−
{{#set: consumed by=RXN0-1603}}
+

Latest revision as of 19:52, 21 March 2018

Reaction RXNQT-4142

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 β-L-galactose 1-phosphate[c] + 1 H2O[c] => 1 L-galactopyranose[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-882, L-ascorbate biosynthesis I (L-galactose pathway): PWY-882
    • 7 reactions found over 8 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXNQT-4142&oldid=29889"