Difference between revisions of "CPD-9451"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_005280 == * left end position: ** 4547325 * transcription direction: ** POSITIVE * right end position: ** 4554856 * centisome position: ** 44.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * inchi key: ** InChIKey=NJMGRJ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(C(=O)[O-])=CC(=O)[O-])C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L |
− | * | + | * common name: |
− | ** | + | ** 2-isopropylmaleate |
− | * | + | * molecular weight: |
− | ** | + | ** 156.138 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-isopropylmaleate |
− | ** | + | ** 2-isopropylmaleic acid |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
− | + | * [[RXN-8991]] | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21954611 21954611] |
− | {{#set: | + | * HMDB : HMDB12241 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02631 C02631] |
− | {{#set: reaction associated=3 | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.10710392.html 10710392] | |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58085 58085] | ||
+ | * BIGG : 40241 | ||
+ | {{#set: smiles=CC(C(C(=O)[O-])=CC(=O)[O-])C}} | ||
+ | {{#set: inchi key=InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L}} | ||
+ | {{#set: common name=2-isopropylmaleate}} | ||
+ | {{#set: molecular weight=156.138 }} | ||
+ | {{#set: common name=β-isopropylmaleate|2-isopropylmaleic acid}} | ||
+ | {{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}} |
Latest revision as of 20:52, 21 March 2018
Contents
Metabolite CPD-9451
- smiles:
- CC(C(C(=O)[O-])=CC(=O)[O-])C
- inchi key:
- InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
- common name:
- 2-isopropylmaleate
- molecular weight:
- 156.138
- Synonym(s):
- β-isopropylmaleate
- 2-isopropylmaleic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12241
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 40241
"CC(C(C(=O)[O-])=CC(=O)[O-])C" cannot be used as a page name in this wiki.