Difference between revisions of "2-OXOSUCCINAMATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_004180 == * left end position: ** 4367532 * transcription direction: ** POSITIVE * right end position: ** 4380177 * centisome position: ** 84.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OXOSUCCINAMATE 2-OXOSUCCINAMATE] == * smiles: ** C(C(N)=O)C(=O)C([O-])=O * common name: ** 2-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OXOSUCCINAMATE 2-OXOSUCCINAMATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(N)=O)C(=O)C([O-])=O |
− | * | + | * common name: |
− | ** | + | ** 2-oxosuccinamate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ONGPAWNLFDCRJE-UHFFFAOYSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 130.08 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-oxosuccinamate |
− | ** | + | ** ketosuccinamate |
+ | ** L-keto-succinamate | ||
+ | ** α-ketosuccinamate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[2.6.1.14-RXN-P-HYDROXY-PHENYLPYRUVATE/ASN//2-OXOSUCCINAMATE/TYR.51.]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145025 21145025] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20015802.html 20015802] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57735 57735] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02362 C02362] | ||
+ | {{#set: smiles=C(C(N)=O)C(=O)C([O-])=O}} | ||
+ | {{#set: common name=2-oxosuccinamate}} | ||
+ | {{#set: inchi key=InChIKey=ONGPAWNLFDCRJE-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=130.08 }} | ||
+ | {{#set: common name=L-oxosuccinamate|ketosuccinamate|L-keto-succinamate|α-ketosuccinamate}} | ||
+ | {{#set: reversible reaction associated=2.6.1.14-RXN-P-HYDROXY-PHENYLPYRUVATE/ASN//2-OXOSUCCINAMATE/TYR.51.}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite 2-OXOSUCCINAMATE
- smiles:
- C(C(N)=O)C(=O)C([O-])=O
- common name:
- 2-oxosuccinamate
- inchi key:
- InChIKey=ONGPAWNLFDCRJE-UHFFFAOYSA-M
- molecular weight:
- 130.08
- Synonym(s):
- L-oxosuccinamate
- ketosuccinamate
- L-keto-succinamate
- α-ketosuccinamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(N)=O)C(=O)C([O-])=O" cannot be used as a page name in this wiki.