Difference between revisions of "TDP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG-tRNAs ARG-tRNAs] == * common name: ** a tRNAarg * Synonym(s): ** TRNA(ARG) == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) * in...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == |
+ | * smiles: | ||
+ | ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=UJLXYODCHAELLY-XLPZGREQSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** dTDP |
+ | * molecular weight: | ||
+ | ** 399.167 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** TDP |
+ | ** thymidine 5'-(trihydrogen diphosphate) (9CI) | ||
+ | ** deoxy-TDP | ||
+ | ** thymidine-5'-diphosphate | ||
+ | ** thymidine-diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DTDPKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DTMPKI-RXN]] | ||
+ | * [[THYMIDINE-TRIPHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-14213]] |
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 491-97-4 |
− | {{#set: common name= | + | * BIGG : 34750 |
− | {{#set: consumed by= | + | * PUBCHEM: |
− | {{#set: reversible reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21124327 21124327] |
+ | * HMDB : HMDB01274 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00363 C00363] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19989845.html 19989845] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58369 58369] | ||
+ | * METABOLIGHTS : MTBLC58369 | ||
+ | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2))}} | ||
+ | {{#set: inchi key=InChIKey=UJLXYODCHAELLY-XLPZGREQSA-K}} | ||
+ | {{#set: common name=dTDP}} | ||
+ | {{#set: molecular weight=399.167 }} | ||
+ | {{#set: common name=TDP|thymidine 5'-(trihydrogen diphosphate) (9CI)|deoxy-TDP|thymidine-5'-diphosphate|thymidine-diphosphate}} | ||
+ | {{#set: consumed by=DTDPKIN-RXN}} | ||
+ | {{#set: produced by=DTMPKI-RXN|THYMIDINE-TRIPHOSPHATASE-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14213}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite TDP
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2))
- inchi key:
- InChIKey=UJLXYODCHAELLY-XLPZGREQSA-K
- common name:
- dTDP
- molecular weight:
- 399.167
- Synonym(s):
- TDP
- thymidine 5'-(trihydrogen diphosphate) (9CI)
- deoxy-TDP
- thymidine-5'-diphosphate
- thymidine-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 491-97-4
- BIGG : 34750
- PUBCHEM:
- HMDB : HMDB01274
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58369
"CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2))" cannot be used as a page name in this wiki.