Difference between revisions of "Ec-01 008630"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))...")
(Created page with "Category:Gene == Gene Ec-01_008630 == * left end position: ** 7338894 * transcription direction: ** POSITIVE * right end position: ** 7344090 * centisome position: ** 71.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] ==
+
== Gene Ec-01_008630 ==
−
* smiles:
+
* left end position:
−
** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
** 7338894
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** XXLG xyloglucan oligosaccharide
+
** 7344090
−
* molecular weight:
+
* centisome position:
−
** 1225.073    
+
** 71.121346    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0282_0014
 +
** Esi0282_0014
 +
** NDA
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12398]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1335]]
 +
* [[PWY0-1334]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7338894}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940123 52940123]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: right end position=7344090}}
−
{{#set: inchi key=InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N}}
+
{{#set: centisome position=71.121346    }}
−
{{#set: common name=XXLG xyloglucan oligosaccharide}}
+
{{#set: common name=Esi_0282_0014|Esi0282_0014|NDA}}
−
{{#set: molecular weight=1225.073    }}
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
−
{{#set: consumed by=RXN-12398}}
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1335|PWY0-1334|PWY-4302}}

Latest revision as of 19:52, 21 March 2018

Gene Ec-01_008630

  • left end position:
    • 7338894
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7344090
  • centisome position:
    • 71.121346
  • Synonym(s):
    • Esi_0282_0014
    • Esi0282_0014
    • NDA

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_008630&oldid=29965"