Difference between revisions of "Ec-18 000810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * inchi key: **...")
(Created page with "Category:Gene == Gene Ec-18_000810 == * left end position: ** 784882 * transcription direction: ** POSITIVE * right end position: ** 795758 * centisome position: ** 15.931...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] ==
+
== Gene Ec-18_000810 ==
−
* smiles:
+
* left end position:
−
** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
+
** 784882
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** D-mannitol 1-phosphate
+
** 795758
−
* molecular weight:
+
* centisome position:
−
** 260.137    
+
** 15.931654    
 
* Synonym(s):
 
* Synonym(s):
−
** mannitol-1-P
+
** Esi_0020_0111
 +
** Esi0020_0111
 +
** PP2C
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[MANNITOL-1-PHOSPHATASE-RXN]]
+
* Reaction: [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[MANNPDEHYDROG-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 15806-48-1
+
{{#set: left end position=784882}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615341 23615341]
+
{{#set: right end position=795758}}
−
* HMDB : HMDB01530
+
{{#set: centisome position=15.931654   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0020_0111|Esi0020_0111|PP2C}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00644 C00644]
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19951338.html 19951338]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61381 61381]
+
−
* BIGG : 35604
+
−
{{#set: smiles=C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L}}
+
−
{{#set: common name=D-mannitol 1-phosphate}}
+
−
{{#set: molecular weight=260.137   }}
+
−
{{#set: common name=mannitol-1-P}}
+
−
{{#set: consumed by=MANNITOL-1-PHOSPHATASE-RXN}}
+
−
{{#set: reversible reaction associated=MANNPDEHYDROG-RXN}}
+

Latest revision as of 19:52, 21 March 2018

Gene Ec-18_000810

  • left end position:
    • 784882
  • transcription direction:
    • POSITIVE
  • right end position:
    • 795758
  • centisome position:
    • 15.931654
  • Synonym(s):
    • Esi_0020_0111
    • Esi0020_0111
    • PP2C

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_000810&oldid=29971"