Difference between revisions of "CPD-7496"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_002020 == * left end position: ** 2153580 * transcription direction: ** NEGATIVE * right end position: ** 2156572 * centisome position: ** 34.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N |
− | * | + | * common name: |
− | ** | + | ** prolycopene |
− | * | + | * molecular weight: |
− | ** | + | ** 536.882 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7,9,9',7'-tetra-cis-lycopene |
− | ** | + | ** 9,9'-di-cis-ζ-carotene |
+ | ** 7,9,9',7'-tetracis-lycopene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-11357]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-12242]] |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10918539 10918539] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62466 62466] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: reaction associated= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15858 C15858] |
+ | * HMDB : HMDB35776 | ||
+ | {{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N}} | ||
+ | {{#set: common name=prolycopene}} | ||
+ | {{#set: molecular weight=536.882 }} | ||
+ | {{#set: common name=7,9,9',7'-tetra-cis-lycopene|9,9'-di-cis-ζ-carotene|7,9,9',7'-tetracis-lycopene}} | ||
+ | {{#set: produced by=RXN-11357}} | ||
+ | {{#set: reversible reaction associated=RXN-12242}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-7496
- smiles:
- CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C
- inchi key:
- InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N
- common name:
- prolycopene
- molecular weight:
- 536.882
- Synonym(s):
- 7,9,9',7'-tetra-cis-lycopene
- 9,9'-di-cis-ζ-carotene
- 7,9,9',7'-tetracis-lycopene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links