Difference between revisions of "RXN0-2023"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] == * direction: ** LEFT-TO-RIGHT * common name: ** tRNA-specific 2-thiouridyla...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** tRNA-specific 2-thiouridylase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.8.1.13 EC-2.8.1.13] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[Donor-H2]][c] '''+''' 1 [[TusE-S-sulfanylcysteine]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[tRNA-uridine34]][c] '''=>''' 1 [[tRNA-2-thiouridine34]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[TusE-L-cysteine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an reduced unknown electron acceptor[c] '''+''' 1 a [TusE sulfur carrier protein]-S-sulfanylcysteine[c] '''+''' 1 ATP[c] '''+''' 1 a uridine34 in tRNA[c] '''=>''' 1 a 2-thiouridine34 in tRNA[c] '''+''' 1 an oxidized unknown electron acceptor[c] '''+''' 1 a [TusE sulfur carrier protein]-L-cysteine[c] '''+''' 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-28_002930]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=tRNA-specific 2-thiouridylase}} | |
| − | + | {{#set: ec number=EC-2.8.1.13}} | |
| − | {{#set: | + | {{#set: gene associated=Ec-28_002930}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
Latest revision as of 19:17, 21 March 2018
Contents
Reaction RXN0-2023
- direction:
- LEFT-TO-RIGHT
- common name:
- tRNA-specific 2-thiouridylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Donor-H2[c] + 1 TusE-S-sulfanylcysteine[c] + 1 ATP[c] + 1 tRNA-uridine34[c] => 1 tRNA-2-thiouridine34[c] + 1 Acceptor[c] + 1 TusE-L-cysteine[c] + 1 PROTON[c] + 1 AMP[c] + 1 PPI[c]
- With common name(s):
- 1 an reduced unknown electron acceptor[c] + 1 a [TusE sulfur carrier protein]-S-sulfanylcysteine[c] + 1 ATP[c] + 1 a uridine34 in tRNA[c] => 1 a 2-thiouridine34 in tRNA[c] + 1 an oxidized unknown electron acceptor[c] + 1 a [TusE sulfur carrier protein]-L-cysteine[c] + 1 H+[c] + 1 AMP[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-28_002930
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
