Difference between revisions of "Ec-05 006710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == * smiles: ** CC(O)(CO)C(O)COP(OP([O-]...")
(Created page with "Category:Gene == Gene Ec-05_006710 == * left end position: ** 8811113 * transcription direction: ** POSITIVE * right end position: ** 8818715 * centisome position: ** 96.7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] ==
+
== Gene Ec-05_006710 ==
−
* smiles:
+
* left end position:
−
** CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O
+
** 8811113
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
+
** 8818715
−
* molecular weight:
+
* centisome position:
−
** 519.295    
+
** 96.78815    
 
* Synonym(s):
 
* Synonym(s):
−
** CDP-ME
+
** Esi_0153_0050
−
** CDP-methyl-D-erythritol
+
** Esi0153_0050
−
** 4-diphosphocytidyl-2C-methyl-D-erythritol
+
** UDP-glucose 4-ep
−
** 4-diphosphocytidyl-2-C-methylerythritol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[2.7.1.148-RXN]]
+
* Reaction: [[UDPGLUCEPIM-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[2.7.7.60-RXN]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7344]]
 +
* [[PWY-6397]]
 +
* [[COLANSYN-PWY]]
 +
* [[PWY-6527]]
 +
* [[PWY-7328]]
 +
* [[PWY-6317]]
 +
* [[PWY66-422]]
 +
* [[PWY-3821]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=8811113}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24970669 24970669]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=8818715}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57823 57823]
+
{{#set: centisome position=96.78815   }}
−
* BIGG : 216317
+
{{#set: common name=Esi_0153_0050|Esi0153_0050|UDP-glucose 4-ep}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=UDPGLUCEPIM-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11435 C11435]
+
{{#set: pathway associated=PWY-7344|PWY-6397|COLANSYN-PWY|PWY-6527|PWY-7328|PWY-6317|PWY66-422|PWY-3821}}
−
{{#set: smiles=CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L}}
+
−
{{#set: common name=4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}}
+
−
{{#set: molecular weight=519.295   }}
+
−
{{#set: common name=CDP-ME|CDP-methyl-D-erythritol|4-diphosphocytidyl-2C-methyl-D-erythritol|4-diphosphocytidyl-2-C-methylerythritol}}
+
−
{{#set: consumed by=2.7.1.148-RXN}}
+
−
{{#set: produced by=2.7.7.60-RXN}}
+

Latest revision as of 19:53, 21 March 2018

Gene Ec-05_006710

  • left end position:
    • 8811113
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8818715
  • centisome position:
    • 96.78815
  • Synonym(s):
    • Esi_0153_0050
    • Esi0153_0050
    • UDP-glucose 4-ep

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_006710&oldid=30046"