Difference between revisions of "RXN66-474"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] == * smiles: ** C([O-])(=O)C([N+])CC(=O)C1(=C(N)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474 RXN66-474] == * direction: ** LEFT-TO-RIGHT * common name: ** straight chain (R)-2-hydrox...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474 RXN66-474] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VCKPUUFAIGNJHC-LURJTMIESA-N
+
 
* common name:
 
* common name:
−
** 3-hydroxy-L-kynurenine
+
** straight chain (R)-2-hydroxy fatty acyl-CoA ligase
−
* molecular weight:
+
* ec number:
−
** 224.216   
+
** [http://enzyme.expasy.org/EC/6.2.1 EC-6.2.1]
 
* Synonym(s):
 
* Synonym(s):
−
** L-3-hydroxykynurenine
 
−
** 3-hydroxy-kynurenine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
+
** 1 [[R2OH-Straight-Chain-234-Sat-FA]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[R2-2OH-Straight-Chain-234-Sat-FA-CoA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-10721]]
+
** 1 a (2R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acid[c] '''+''' 1 coenzyme A[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 a (R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acyl CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 606-14-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=straight chain (R)-2-hydroxy fatty acyl-CoA ligase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791998 49791998]
+
{{#set: ec number=EC-6.2.1}}
−
* HMDB : HMDB11631
+
{{#set: in pathway=PWY66-388}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02794 C02794]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58125 58125]
+
−
* METABOLIGHTS : MTBLC58125
+
−
{{#set: smiles=C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1)}}
+
−
{{#set: inchi key=InChIKey=VCKPUUFAIGNJHC-LURJTMIESA-N}}
+
−
{{#set: common name=3-hydroxy-L-kynurenine}}
+
−
{{#set: molecular weight=224.216    }}
+
−
{{#set: common name=L-3-hydroxykynurenine|3-hydroxy-kynurenine}}
+
−
{{#set: produced by=KYNURENINE-3-MONOOXYGENASE-RXN}}
+
−
{{#set: reversible reaction associated=RXN-10721}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXN66-474

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • straight chain (R)-2-hydroxy fatty acyl-CoA ligase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY66-388, fatty acid α-oxidation III: PWY66-388
    • 4 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-474&oldid=30058"