Difference between revisions of "RXN-14224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14224 RXN-14224] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.2...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14224 RXN-14224] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
−
* common name:
+
−
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
+
−
* molecular weight:
+
−
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5α-cholesta-8,24-dien-3β-ol
 
−
** 4α,14α-dimethylzymosterol
 
−
** 29-norlanosterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11881]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[CPD-15163]][c] '''<=>''' 1 [[CPD-661]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 NAD+[c] '''+''' 1 prop-2-ynal[c] '''<=>''' 1 propynoate[c] '''+''' 2 H+[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_002450]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986191 50986191]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30882 30882]
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R02940 R02940]
−
{{#set: common name=4&alpha;,14&alpha;-dimethyl-5&alpha;-cholesta-8,24-dien-3&beta;-ol}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: molecular weight=412.698    }}
+
{{#set: ec number=EC-1.2.1.3}}
−
{{#set: common name=5&alpha;-cholesta-8,24-dien-3&beta;-ol|4&alpha;,14&alpha;-dimethylzymosterol|29-norlanosterol}}
+
{{#set: gene associated=Ec-11_002450}}
−
{{#set: consumed by=RXN-11881}}
+
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:54, 21 March 2018

Reaction RXN-14224

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 NAD+[c] + 1 prop-2-ynal[c] <=> 1 propynoate[c] + 2 H+[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14224&oldid=30145"