Difference between revisions of "RXN0-722"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate re...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-722 RXN0-722] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor |
− | * | + | ** EsV-1-128 |
− | ** | + | ** EsV-1-180 |
+ | ** Ribonucleoside-diphosphate reductase small chain | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[UDP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[DUDP]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 UDP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 dUDP[c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-19_000440]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-11_002170]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-06_005570]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-21_002920]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-06_005120]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166] | ||
+ | ** '''14''' reactions found over '''17''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}} | |
− | + | {{#set: common name=EsV-1-128}} | |
− | + | {{#set: common name=EsV-1-180}} | |
− | + | {{#set: common name=Ribonucleoside-diphosphate reductase small chain}} | |
− | + | {{#set: ec number=EC-1.17.4.1}} | |
− | + | {{#set: gene associated=Ec-19_000440|Ec-11_002170|Ec-06_005570|Ec-21_002920|Ec-06_005120}} | |
− | + | {{#set: in pathway=PWY0-166}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:54, 21 March 2018
Contents
Reaction RXN0-722
- direction:
- LEFT-TO-RIGHT
- common name:
- ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor
- EsV-1-128
- EsV-1-180
- Ribonucleoside-diphosphate reductase small chain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 UDP[c] + 1 Reduced-NrdH-Proteins[c] => 1 Oxidized-NrdH-Proteins[c] + 1 DUDP[c] + 1 WATER[c]
- With common name(s):
- 1 UDP[c] + 1 a reduced NrdH glutaredoxin-like protein[c] => 1 an oxidized NrdH glutaredoxin-like protein[c] + 1 dUDP[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-19_000440
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-11_002170
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_005570
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-21_002920
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_005120
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY0-166, superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): PWY0-166
- 14 reactions found over 17 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome