Difference between revisions of "RXN0-884"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-884 RXN0-884] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-hydroxy-3-methylbut-2-enyl...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-884 RXN0-884] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-3-methylbut-2-enyl diphosphate reductase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.17.7.4 EC-1.17.7.4] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 2 [[Reduced-ferredoxins]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c] '''=>''' 1 [[CPD-4211]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[Oxidized-ferredoxins]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 2 H+[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] '''=>''' 1 dimethylallyl diphosphate[c] '''+''' 1 H2O[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-06_002680]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY] | ||
| + | ** '''8''' reactions found over '''9''' reactions in the full pathway | ||
| + | * [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560] | ||
| + | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08210 R08210] | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07219 R07219] | |
| − | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: common name=4-hydroxy-3-methylbut-2-enyl diphosphate reductase}} | |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.17.7.4}} |
| − | + | {{#set: gene associated=Ec-06_002680}} | |
| − | {{#set: | + | {{#set: in pathway=NONMEVIPP-PWY|PWY-7560}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:55, 21 March 2018
Contents
Reaction RXN0-884
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 Reduced-ferredoxins[c] + 2 PROTON[c] + 1 HYDROXY-METHYL-BUTENYL-DIP[c] => 1 CPD-4211[c] + 1 WATER[c] + 2 Oxidized-ferredoxins[c]
- With common name(s):
- 2 a reduced ferredoxin [iron-sulfur] cluster[c] + 2 H+[c] + 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] => 1 dimethylallyl diphosphate[c] + 1 H2O[c] + 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_002680
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- NONMEVIPP-PWY, methylerythritol phosphate pathway I: NONMEVIPP-PWY
- 8 reactions found over 9 reactions in the full pathway
- PWY-7560, methylerythritol phosphate pathway II: PWY-7560
- 9 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
