Difference between revisions of "CPDQT-4"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_002880 == * left end position: ** 2213636 * transcription direction: ** NEGATIVE * right end position: ** 2223495 * centisome position: ** 25.2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-06_002880 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] ==
* left end position:
+
* smiles:
** 2213636
+
** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
* right end position:
+
* common name:
** 2223495
+
** β-L-galactose 1-phosphate
* centisome position:
+
* molecular weight:
** 25.276285    
+
** 258.121    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0165_0003
 
** Esi0165_0003
 
** PAO-like
 
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[RXN-13398]]
+
* [[RXNQT-4142]]
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: go-term
+
* [[RXNQT-4141]]
* Reaction: [[RXN-7676]]
+
== Reaction(s) of unknown directionality ==
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: go-term
+
* Reaction: [[RXN-7677]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: go-term
+
== Pathways associated ==
+
* [[PWY-5068]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2213636}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461]
{{#set: right end position=2223495}}
+
* CHEBI:
{{#set: centisome position=25.276285    }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522]
{{#set: common name=Esi_0165_0003|Esi0165_0003|PAO-like}}
+
* LIGAND-CPD:
{{#set: reaction associated=RXN-13398|RXN-7676|RXN-7677}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926]
{{#set: pathway associated=PWY-5068}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}}
 +
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}}
 +
{{#set: common name=β-L-galactose 1-phosphate}}
 +
{{#set: molecular weight=258.121    }}
 +
{{#set: consumed by=RXNQT-4142}}
 +
{{#set: produced by=RXNQT-4141}}

Latest revision as of 19:55, 21 March 2018

Metabolite CPDQT-4

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
  • inchi key:
    • InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
  • common name:
    • β-L-galactose 1-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)" cannot be used as a page name in this wiki.