Difference between revisions of "2.5.1.39-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.39-RXN 2.5.1.39-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-hydroxybenzoate non...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.39-RXN 2.5.1.39-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-hydroxybenzoate nonaprenyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[SOLANESYL-PYROPHOSPHATE]][c] '''=>''' 1 [[NONAPRENYL-4-HYDROXYBENZOATE]][c] '''+''' 1 [[PPI]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 4-hydroxybenzoate[c] '''+''' 1 all-trans-nonaprenyl diphosphate[c] '''=>''' 1 3-nonaprenyl-4-hydroxybenzoate[c] '''+''' 1 diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-00_007360]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5871]], ubiquinol-9 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5871 PWY-5871] | ||
+ | ** '''1''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-5856]], ubiquinol-9 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856] | ||
+ | ** '''1''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-6978]], plastoquinol-9 biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6978 PWY-6978] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17709 17709] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07273 R07273] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=4-hydroxybenzoate nonaprenyltransferase}} | |
− | ** [http:// | + | {{#set: ec number=EC-2.5.1.39}} |
− | + | {{#set: gene associated=Ec-00_007360}} | |
− | {{#set: | + | {{#set: in pathway=PWY-5871|PWY-5856|PWY-6978}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:55, 21 March 2018
Contents
Reaction 2.5.1.39-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-hydroxybenzoate nonaprenyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 4-hydroxybenzoate[c] + 1 SOLANESYL-PYROPHOSPHATE[c] => 1 NONAPRENYL-4-HYDROXYBENZOATE[c] + 1 PPI[c]
- With common name(s):
- 1 4-hydroxybenzoate[c] + 1 all-trans-nonaprenyl diphosphate[c] => 1 3-nonaprenyl-4-hydroxybenzoate[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_007360
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5871, ubiquinol-9 biosynthesis (eukaryotic): PWY-5871
- 1 reactions found over 8 reactions in the full pathway
- PWY-5856, ubiquinol-9 biosynthesis (prokaryotic): PWY-5856
- 1 reactions found over 8 reactions in the full pathway
- PWY-6978, plastoquinol-9 biosynthesis II: PWY-6978
- 1 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links