Difference between revisions of "Ec-27 004350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Gene == Gene Ec-27_004350 == * left end position: ** 3807534 * transcription direction: ** POSITIVE * right end position: ** 3812174 * centisome position: ** 59.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] ==
+
== Gene Ec-27_004350 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 3807534
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** OPC8-3-ketoacyl-CoA
+
** 3812174
−
* molecular weight:
+
* centisome position:
−
** 1053.904    
+
** 59.032387    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0000_0390
 +
** Esi0000_0390
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
−
* [[RXN-10698]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15035]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3807534}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237200 44237200]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: right end position=3812174}}
−
{{#set: inchi key=InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J}}
+
{{#set: centisome position=59.032387    }}
−
{{#set: common name=OPC8-3-ketoacyl-CoA}}
+
{{#set: common name=Esi_0000_0390|Esi0000_0390}}
−
{{#set: molecular weight=1053.904    }}
+
{{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}}
−
{{#set: produced by=RXN-10698}}
+
{{#set: pathway associated=PWY-7409}}

Latest revision as of 19:56, 21 March 2018

Gene Ec-27_004350

  • left end position:
    • 3807534
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3812174
  • centisome position:
    • 59.032387
  • Synonym(s):
    • Esi_0000_0390
    • Esi0000_0390

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_004350&oldid=30351"