Difference between revisions of "RXN1G-4355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == * smiles: ** C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4355 RXN1G-4355] == * direction: ** LEFT-TO-RIGHT * common name: ** propionyl-CoA carboxylase...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4355 RXN1G-4355] ==
* smiles:
+
* direction:
** C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L
+
 
* common name:
 
* common name:
** ADP-α-D-glucose
+
** propionyl-CoA carboxylase, alpha subunit
* molecular weight:
+
* ec number:
** 587.33   
+
** [http://enzyme.expasy.org/EC/6.4.1.3 EC-6.4.1.3]
 
* Synonym(s):
 
* Synonym(s):
** adenosine diphosphate glucose
 
** ADP-glucose
 
** ADP-D-glucose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD1G-277]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[HCO3]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[CPD1G-332]][c] '''+''' 1 [[Pi]][c]
* [[RXN-761]]
+
* With common name(s):
 +
** 1 cerotoyl-CoA[c] '''+''' 1 ATP[c] '''+''' 1 hydrogen carbonate[c] '''=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 2-carboxy-cerotoyl-CoA[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_010970]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''30''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 2140-58-1
+
{{#set: direction=LEFT-TO-RIGHT}}
* BIGG : 35161
+
{{#set: common name=propionyl-CoA carboxylase, alpha subunit}}
* PUBCHEM:
+
{{#set: ec number=EC-6.4.1.3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=42609821 42609821]
+
{{#set: gene associated=Ec-01_010970}}
* HMDB : HMDB06557
+
{{#set: in pathway=PWYG-321}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00498 C00498]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57498 57498]
+
* METABOLIGHTS : MTBLC57498
+
{{#set: smiles=C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O}}
+
{{#set: inchi key=InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L}}
+
{{#set: common name=ADP-α-D-glucose}}
+
{{#set: molecular weight=587.33    }}
+
{{#set: common name=adenosine diphosphate glucose|ADP-glucose|ADP-D-glucose}}
+
{{#set: reversible reaction associated=RXN-761}}
+

Latest revision as of 19:56, 21 March 2018

Reaction RXN1G-4355

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • propionyl-CoA carboxylase, alpha subunit
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cerotoyl-CoA[c] + 1 ATP[c] + 1 hydrogen carbonate[c] => 1 H+[c] + 1 ADP[c] + 1 2-carboxy-cerotoyl-CoA[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 30 reactions found over 182 reactions in the full pathway

Reconstruction information

External links