Difference between revisions of "Ec-16 002420"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == * smiles: ** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C...")
(Created page with "Category:Gene == Gene Ec-16_002420 == * left end position: ** 2635159 * transcription direction: ** NEGATIVE * right end position: ** 2646510 * centisome position: ** 49.3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] ==
+
== Gene Ec-16_002420 ==
−
* smiles:
+
* left end position:
−
** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
+
** 2635159
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 7,8-dihydropteroate
+
** 2646510
−
* molecular weight:
+
* centisome position:
−
** 313.295    
+
** 49.369236    
 
* Synonym(s):
 
* Synonym(s):
−
** dihydropterate
+
** Esi_0283_0006
−
** H2Pte
+
** Esi0283_0006
−
** dihydropteroate
+
** PDK2
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DIHYDROFOLATESYNTH-RXN]]
+
* Reaction: [[2.7.11.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[H2PTEROATESYNTH-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[2.7.11.4-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2635159}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459950 5459950]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB01412
+
{{#set: right end position=2646510}}
−
* LIGAND-CPD:
+
{{#set: centisome position=49.369236   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00921 C00921]
+
{{#set: common name=Esi_0283_0006|Esi0283_0006|PDK2}}
−
* CHEMSPIDER:
+
{{#set: reaction associated=2.7.11.2-RXN|2.7.11.4-RXN}}
−
** [http://www.chemspider.com/Chemical-Structure.4573669.html 4573669]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17839 17839]
+
−
* BIGG : 36380
+
−
{{#set: smiles=C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}}
+
−
{{#set: inchi key=InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M}}
+
−
{{#set: common name=7,8-dihydropteroate}}
+
−
{{#set: molecular weight=313.295   }}
+
−
{{#set: common name=dihydropterate|H2Pte|dihydropteroate}}
+
−
{{#set: consumed by=DIHYDROFOLATESYNTH-RXN}}
+
−
{{#set: produced by=H2PTEROATESYNTH-RXN}}
+

Latest revision as of 19:56, 21 March 2018

Gene Ec-16_002420

  • left end position:
    • 2635159
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2646510
  • centisome position:
    • 49.369236
  • Synonym(s):
    • Esi_0283_0006
    • Esi0283_0006
    • PDK2

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_002420&oldid=30448"