Difference between revisions of "7-8-DIHYDROPTEROATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10279 CPD-10279] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == * smiles: ** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 7,8-dihydropteroate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 313.295 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dihydropterate |
+ | ** H2Pte | ||
+ | ** dihydropteroate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DIHYDROFOLATESYNTH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[H2PTEROATESYNTH-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459950 5459950] |
+ | * HMDB : HMDB01412 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00921 C00921] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573669.html 4573669] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17839 17839] |
− | {{#set: smiles= | + | * BIGG : 36380 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M}} |
− | {{#set: molecular weight= | + | {{#set: common name=7,8-dihydropteroate}} |
− | {{#set: common name= | + | {{#set: molecular weight=313.295 }} |
− | {{#set: consumed by= | + | {{#set: common name=dihydropterate|H2Pte|dihydropteroate}} |
− | {{#set: produced by= | + | {{#set: consumed by=DIHYDROFOLATESYNTH-RXN}} |
+ | {{#set: produced by=H2PTEROATESYNTH-RXN}} |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite 7-8-DIHYDROPTEROATE
- smiles:
- C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
- inchi key:
- InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M
- common name:
- 7,8-dihydropteroate
- molecular weight:
- 313.295
- Synonym(s):
- dihydropterate
- H2Pte
- dihydropteroate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))" cannot be used as a page name in this wiki.