Difference between revisions of "CPD-17324"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo adrenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1091.996 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 3- | + | ** 3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA |
| − | + | ** 3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA | |
| − | ** | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16112]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16079]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581099 71581099] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73852 73852] |
| − | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J}} | |
| − | {{#set: smiles= | + | {{#set: common name=3-oxo adrenoyl-CoA}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=1091.996 }} |
| − | {{#set: common name= | + | {{#set: common name=3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=RXN-16112}} |
| − | {{#set: common name=3- | + | {{#set: produced by=RXN-16079}} |
| − | {{#set: consumed by= | + | |
| − | {{#set: | + | |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-17324
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=VMAJWSSWCPBIJY-KPOVBLHLSA-J
- common name:
- 3-oxo adrenoyl-CoA
- molecular weight:
- 1091.996
- Synonym(s):
- 3-oxo-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
- 3-oxo-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
