Difference between revisions of "Ec-16 001550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
(Created page with "Category:Gene == Gene Ec-16_001550 == * left end position: ** 1757528 * transcription direction: ** POSITIVE * right end position: ** 1762175 * centisome position: ** 32.9...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
+
== Gene Ec-16_001550 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 1757528
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** dihydrogeranylgeranyl chlorophyll a
+
** 1762175
−
* molecular weight:
+
* centisome position:
−
** 888.463    
+
** 32.926975    
 
* Synonym(s):
 
* Synonym(s):
−
** dihydrogeranylgeranyl-chl a
+
** Esi_0488_0013
−
** dihydroGG-chl a
+
** Esi0488_0013
−
** dihydroGG-chlorophyll a
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7665]]
+
* Reaction: [[2.7.11.4-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7664]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1757528}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: right end position=1762175}}
−
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
+
{{#set: centisome position=32.926975   }}
−
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
+
{{#set: common name=Esi_0488_0013|Esi0488_0013}}
−
{{#set: molecular weight=888.463   }}
+
{{#set: reaction associated=2.7.11.4-RXN}}
−
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
+
−
{{#set: consumed by=RXN-7665}}
+
−
{{#set: produced by=RXN-7664}}
+

Latest revision as of 19:57, 21 March 2018

Gene Ec-16_001550

  • left end position:
    • 1757528
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1762175
  • centisome position:
    • 32.926975
  • Synonym(s):
    • Esi_0488_0013
    • Esi0488_0013

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_001550&oldid=30589"