Difference between revisions of "3-ENOLPYRUVYL-SHIKIMATE-5P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-09_004680 == * left end position: ** 5307215 * transcription direction: ** NEGATIVE * right end position: ** 5311116 * centisome position: ** 94.5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-09_004680 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
−
* left end position:
+
* smiles:
−
** 5307215
+
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
−
* right end position:
+
* common name:
−
** 5311116
+
** 5-enolpyruvoyl-shikimate 3-phosphate
−
* centisome position:
+
* molecular weight:
−
** 94.54949    
+
** 320.149    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0049_0025
+
** 3-enolpyruvyl-shikimate 5-phosphate
−
** Esi0049_0025
+
** 3-enolpyruvyl-shikimate-5-P
−
** GPX
+
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
 +
** 5-enolpyruvyl-shikimate 3-phosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
* [[CHORISMATE-SYNTHASE-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
* [[2.5.1.19-RXN]]
−
* [[DETOX1-PWY-1]]
+
−
* [[PWY-4081]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5307215}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
−
{{#set: right end position=5311116}}
+
* CHEBI:
−
{{#set: centisome position=94.54949   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
−
{{#set: common name=Esi_0049_0025|Esi0049_0025|GPX}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
−
{{#set: pathway associated=DETOX1-PWY-1|PWY-4081}}
+
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
 +
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
 +
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
 +
{{#set: molecular weight=320.149   }}
 +
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
 +
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
 +
{{#set: reversible reaction associated=2.5.1.19-RXN}}

Latest revision as of 19:18, 21 March 2018

Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P

  • smiles:
    • C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
  • inchi key:
    • InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
  • common name:
    • 5-enolpyruvoyl-shikimate 3-phosphate
  • molecular weight:
    • 320.149
  • Synonym(s):
    • 3-enolpyruvyl-shikimate 5-phosphate
    • 3-enolpyruvyl-shikimate-5-P
    • 5-O-(1-carboxyvinyl)-3-phosphoshikimate
    • 5-enolpyruvyl-shikimate 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-ENOLPYRUVYL-SHIKIMATE-5P&oldid=25938"