Difference between revisions of "Ec-07 000930"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
(Created page with "Category:Gene == Gene Ec-07_000930 == * left end position: ** 1043530 * transcription direction: ** POSITIVE * right end position: ** 1061149 * centisome position: ** 13.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] ==
+
== Gene Ec-07_000930 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 1043530
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** OPC6-trans-2-enoyl-CoA
+
** 1061149
−
* molecular weight:
+
* centisome position:
−
** 1009.851    
+
** 13.512975    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0045_0034
 +
** Esi0045_0034
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10704]]
+
* Reaction: [[ACID-PHOSPHATASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-10706]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-5822]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-6348]]
 +
* [[PWY-5083]]
 +
* [[NADPHOS-DEPHOS-PWY]]
 +
* [[NAD-BIOSYNTHESIS-II]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1043530}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237321 44237321]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: right end position=1061149}}
−
{{#set: inchi key=InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J}}
+
{{#set: centisome position=13.512975    }}
−
{{#set: common name=OPC6-trans-2-enoyl-CoA}}
+
{{#set: common name=Esi_0045_0034|Esi0045_0034}}
−
{{#set: molecular weight=1009.851    }}
+
{{#set: reaction associated=ACID-PHOSPHATASE-RXN|RXN-5822}}
−
{{#set: consumed by=RXN-10704}}
+
{{#set: pathway associated=PWY-6348|PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}}
−
{{#set: produced by=RXN-10706}}
+

Latest revision as of 19:58, 21 March 2018

Gene Ec-07_000930

  • left end position:
    • 1043530
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1061149
  • centisome position:
    • 13.512975
  • Synonym(s):
    • Esi_0045_0034
    • Esi0045_0034

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_000930&oldid=30666"