Difference between revisions of "CPD-9700"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACET ACET] == * smiles: ** CC([O-])=O * inchi key: ** InChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-M * co...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * inchi key...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == |
* smiles: | * smiles: | ||
| − | ** CC([O-])=O | + | ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M |
* common name: | * common name: | ||
| − | ** | + | ** hypoglycin B |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 269.277 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** hypoglycine B |
| − | ** | + | ** L-gamma-glutamyl-L-hypoglycin |
| + | ** γ-glutamyl-β-(methylenecyclopropyl)-alanine | ||
| + | ** (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-9157]] | |
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135] |
| − | * | + | * Wikipedia : Hypoglycin_B |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280] |
| − | * | + | * HMDB : HMDB29428 |
| − | + | {{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}} | |
| − | + | {{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}} | |
| − | + | {{#set: common name=hypoglycin B}} | |
| − | + | {{#set: molecular weight=269.277 }} | |
| − | {{#set: smiles=CC([O-])=O}} | + | {{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-9157}} |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-9700
- smiles:
- C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
- inchi key:
- InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
- common name:
- hypoglycin B
- molecular weight:
- 269.277
- Synonym(s):
- hypoglycine B
- L-gamma-glutamyl-L-hypoglycin
- γ-glutamyl-β-(methylenecyclopropyl)-alanine
- (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)" cannot be used as a page name in this wiki.
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}
