Difference between revisions of "CPD0-2121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] == * smiles: ** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] == * smiles: ** CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2121 CPD0-2121] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J |
* common name: | * common name: | ||
| − | ** | + | ** trans-hex-2-enoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 859.631 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** hexenoyl-CoA |
| − | + | ** (2E)-hexenoyl-CoA | |
| − | ** ( | + | ** trans-2-hexenoyl-CoA |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12567]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * BIGG : 45472 | ||
| + | * LIPID_MAPS : LMFA07050019 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921640 52921640] |
| + | * HMDB : HMDB03944 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05271 C05271] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62077 62077] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC28706 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J}} |
| − | {{#set: molecular weight= | + | {{#set: common name=trans-hex-2-enoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: molecular weight=859.631 }} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=hexenoyl-CoA|(2E)-hexenoyl-CoA|trans-2-hexenoyl-CoA}} |
| + | {{#set: produced by=RXN-12567}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD0-2121
- smiles:
- CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=OINXHIBNZUUIMR-IXUYQXAASA-J
- common name:
- trans-hex-2-enoyl-CoA
- molecular weight:
- 859.631
- Synonym(s):
- hexenoyl-CoA
- (2E)-hexenoyl-CoA
- trans-2-hexenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 45472
- LIPID_MAPS : LMFA07050019
- PUBCHEM:
- HMDB : HMDB03944
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC28706
"CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
