Difference between revisions of "Ec-17 003090"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * smiles: ** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
(Created page with "Category:Gene == Gene Ec-17_003090 == * left end position: ** 3296593 * transcription direction: ** POSITIVE * right end position: ** 3303889 * centisome position: ** 68.7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] ==
+
== Gene Ec-17_003090 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3296593
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5-methylhex-4-enoyl-CoA
+
** 3303889
−
* molecular weight:
+
* centisome position:
−
** 873.658    
+
** 68.708405    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0142_0023
 +
** Esi0142_0023
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[F16BDEPHOS-RXN]]
−
* [[RXN-11917]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[GLUCONEO-PWY]]
 +
* [[SUCSYN-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[CALVIN-PWY]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3296593}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986179 50986179]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=3303889}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16470 C16470]
+
{{#set: centisome position=68.708405    }}
−
{{#set: smiles=CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0142_0023|Esi0142_0023}}
−
{{#set: inchi key=InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J}}
+
{{#set: reaction associated=F16BDEPHOS-RXN}}
−
{{#set: common name=5-methylhex-4-enoyl-CoA}}
+
{{#set: pathway associated=GLUCONEO-PWY|SUCSYN-PWY|GLYCOLYSIS|CALVIN-PWY|PWY-5484|P185-PWY|PWY66-399}}
−
{{#set: molecular weight=873.658    }}
+
−
{{#set: produced by=RXN-11917}}
+

Latest revision as of 20:00, 21 March 2018

Gene Ec-17_003090

  • left end position:
    • 3296593
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3303889
  • centisome position:
    • 68.708405
  • Synonym(s):
    • Esi_0142_0023
    • Esi0142_0023

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-17_003090&oldid=30942"