Difference between revisions of "CPD-9663"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_007610 == * left end position: ** 7388118 * transcription direction: ** POSITIVE * right end position: ** 7393220 * centisome position: ** 95.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JCZF...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 2-epi-5-epi-valiolone |
| − | * | + | * molecular weight: |
| − | ** | + | ** 192.168 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-9140]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201976 25201976] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84187 84187] |
| − | {{#set: common name= | + | {{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N}} |
| + | {{#set: common name=2-epi-5-epi-valiolone}} | ||
| + | {{#set: molecular weight=192.168 }} | ||
| + | {{#set: common name=(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}} | ||
| + | {{#set: produced by=RXN-9140}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-9663
- smiles:
- C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
- inchi key:
- InChIKey=JCZFNXYQGNLHDQ-MVIOUDGNSA-N
- common name:
- 2-epi-5-epi-valiolone
- molecular weight:
- 192.168
- Synonym(s):
- (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
