Difference between revisions of "PWY-5493"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5493 PWY-5493] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5493 PWY-5493] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** reductive monocarboxylic acid cycle |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** reductive monocarboxylate cycle |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[PYRUFLAVREDUCT-RXN]] |
| − | * [[ | + | ** 3 associated gene(s): |
| − | * [[ | + | *** [[Ec-18_003420]] |
| − | * [[ | + | *** [[Ec-15_004230]] |
| − | * [[ | + | *** [[Ec-23_002710]] |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PYRUVFORMLY-RXN PYRUVFORMLY-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=reductive monocarboxylic acid cycle}} | |
| − | + | {{#set: common name=reductive monocarboxylate cycle}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:18, 21 March 2018
Pathway PWY-5493
- taxonomic range:
- common name:
- reductive monocarboxylic acid cycle
- Synonym(s):
- reductive monocarboxylate cycle
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- PYRUFLAVREDUCT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
