Difference between revisions of "Ec-06 003770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
 
(Created page with "Category:Gene == Gene Ec-06_003770 == * left end position: ** 3103992 * transcription direction: ** POSITIVE * right end position: ** 3105841 * centisome position: ** 35.4...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Gene Ec-06_003770 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
+
** 3103992
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** 3105841
−
* molecular weight:
+
* centisome position:
−
** 429.662    
+
** 35.44277    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0246_0020
 +
** Esi0246_0020
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-23]]
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3103992}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200717 25200717]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB12166
+
{{#set: right end position=3105841}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: centisome position=35.44277    }}
−
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
+
{{#set: common name=Esi_0246_0020|Esi0246_0020}}
−
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
−
{{#set: molecular weight=429.662    }}
+
−
{{#set: consumed by=RXN66-23}}
+

Latest revision as of 19:18, 21 March 2018

Gene Ec-06_003770

  • left end position:
    • 3103992
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3105841
  • centisome position:
    • 35.44277
  • Synonym(s):
    • Esi_0246_0020
    • Esi0246_0020

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_003770&oldid=26009"