Difference between revisions of "CPD-8619"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIOHBUTANONEPSYN-RXN DIOHBUTANONEPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 3,4-d...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIOHBUTANONEPSYN-RXN DIOHBUTANONEPSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
 
* common name:
 
* common name:
−
** 3,4-dihydroxy-2-butanone-4-phosphate synthase
+
** 4α-carboxy-5α-cholesta-8-en-3β-ol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.1.99.12 EC-4.1.99.12]
+
** 429.662   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-23]]
−
** 1 [[RIBULOSE-5P]][c] '''=>''' 1 [[DIHYDROXY-BUTANONE-P]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 D-ribulose 5-phosphate[c] '''=>''' 1 1-deoxy-L-glycero-tetrulose 4-phosphate[c] '''+''' 1 formate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-27_004040]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-6167]], flavin biosynthesis II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6167 PWY-6167]
+
−
** '''4''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-6168]], flavin biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168]
+
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
−
* [[RIBOSYN2-PWY]], flavin biosynthesis I (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18457 18457]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200717 25200717]
−
* LIGAND-RXN:
+
* HMDB : HMDB12166
−
** [http://www.genome.jp/dbget-bin/www_bget?R07281 R07281]
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
−
{{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate synthase}}
+
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
−
{{#set: ec number=EC-4.1.99.12}}
+
{{#set: molecular weight=429.662    }}
−
{{#set: gene associated=Ec-27_004040}}
+
{{#set: consumed by=RXN66-23}}
−
{{#set: in pathway=PWY-6167|PWY-6168|RIBOSYN2-PWY}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:18, 21 March 2018

Metabolite CPD-8619

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 429.662
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-8619&oldid=26018"