Difference between revisions of "Hexanoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * smiles: ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hexanoyl-ACPs Hexanoyl-ACPs] == * common name: ** a hexanoyl-[acyl-carrier-protein] * Synonym(s...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hexanoyl-ACPs Hexanoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a hexanoyl-[acyl-carrier-protein] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a 5-hexanoyl-[acyl-carrier protein] |
| − | ** | + | ** a 5-hexanoyl-[acp] |
| − | ** | + | ** a hexanoyl-[acp] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9523]] |
| + | * [[RXN-9650]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9658]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a hexanoyl-[acyl-carrier-protein]}} | |
| − | + | {{#set: common name=a 5-hexanoyl-[acyl-carrier protein]|a 5-hexanoyl-[acp]|a hexanoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN-9523|RXN-9650}} | |
| − | + | {{#set: produced by=RXN-9658}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite Hexanoyl-ACPs
- common name:
- a hexanoyl-[acyl-carrier-protein]
- Synonym(s):
- a 5-hexanoyl-[acyl-carrier protein]
- a 5-hexanoyl-[acp]
- a hexanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a hexanoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
- "a 5-hexanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
- "a 5-hexanoyl-[acp" cannot be used as a page name in this wiki.
- "a hexanoyl-[acp" cannot be used as a page name in this wiki.
