Difference between revisions of "CPD-13684"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2962 RXN-2962] == * direction: ** LEFT-TO-RIGHT * common name: ** Alcohol dehydrogenase, C-term...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2962 RXN-2962] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
 
* common name:
 
* common name:
−
** Alcohol dehydrogenase, C-terminal
+
** cholest-5-en-3-one
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.284 EC-1.1.1.284]
+
** 384.644   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[S-HYDROXYMETHYLGLUTATHIONE]][c] '''=>''' 1 [[CPD-548]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-12693]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD(P)+[c] '''+''' 1 S-hydroxymethylglutathione[c] '''=>''' 1 S-formylglutathione[c] '''+''' 1 NAD(P)H[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-16_001960]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-1801]], formaldehyde oxidation II (glutathione-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1801 PWY-1801]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06983 R06983]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107]
−
** [http://www.genome.jp/dbget-bin/www_bget?R07140 R07140]
+
* CHEBI:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906]
−
{{#set: common name=Alcohol dehydrogenase, C-terminal}}
+
* METABOLIGHTS : MTBLC63906
−
{{#set: ec number=EC-1.1.1.284}}
+
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: gene associated=Ec-16_001960}}
+
{{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}}
−
{{#set: in pathway=PWY-1801}}
+
{{#set: common name=cholest-5-en-3-one}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=384.644    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN-12693}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-13684

  • smiles:
    • CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
  • common name:
    • cholest-5-en-3-one
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-13684&oldid=26068"