Difference between revisions of "RIBULOSE-5P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_006640 == * left end position: ** 5953926 * transcription direction: ** POSITIVE * right end position: ** 5960227 * centisome position: ** 71.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FNZLKVNUWIIPSJ-UHNVWZDZSA-L |
− | * | + | * common name: |
− | ** | + | ** D-ribulose 5-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ribulose-5P |
− | ** | + | ** D-ribulose-5-P |
+ | ** ribulose-5-P | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DIOHBUTANONEPSYN-RXN]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-9952]] |
− | == | + | * [[6PGLUCONDEHYDROG-RXN]] |
+ | * [[RXN-3341]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | * [[RIBULP3EPIM-RXN]] | ||
+ | * [[PHOSPHORIBULOKINASE-RXN]] | ||
+ | * [[RIB5PISOM-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 4151-19-3 |
− | {{#set: | + | * BIGG : 34237 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21144996 21144996] |
− | {{#set: common name= | + | * HMDB : HMDB00618 |
− | {{#set: reaction associated= | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00199 C00199] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.20015724.html 20015724] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58121 58121] | ||
+ | * METABOLIGHTS : MTBLC58121 | ||
+ | {{#set: smiles=C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-UHNVWZDZSA-L}} | ||
+ | {{#set: common name=D-ribulose 5-phosphate}} | ||
+ | {{#set: molecular weight=228.095 }} | ||
+ | {{#set: common name=ribulose-5P|D-ribulose-5-P|ribulose-5-P}} | ||
+ | {{#set: consumed by=DIOHBUTANONEPSYN-RXN}} | ||
+ | {{#set: produced by=RXN-9952|6PGLUCONDEHYDROG-RXN|RXN-3341}} | ||
+ | {{#set: reversible reaction associated=RIBULP3EPIM-RXN|PHOSPHORIBULOKINASE-RXN|RIB5PISOM-RXN}} |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite RIBULOSE-5P
- smiles:
- C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O
- inchi key:
- InChIKey=FNZLKVNUWIIPSJ-UHNVWZDZSA-L
- common name:
- D-ribulose 5-phosphate
- molecular weight:
- 228.095
- Synonym(s):
- ribulose-5P
- D-ribulose-5-P
- ribulose-5-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 4151-19-3
- BIGG : 34237
- PUBCHEM:
- HMDB : HMDB00618
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58121
"C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.