Difference between revisions of "PWY-5265"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5265 PWY-5265] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5265 PWY-5265] ==
* smiles:
+
* taxonomic range:
** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
+
 
* common name:
 
* common name:
** β-ketovaleryl-CoA
+
** peptidoglycan biosynthesis II (staphylococci)
* molecular weight:
+
** 861.604   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[PWY-6386]]
* [[RXN-12561]]
+
** 0 associated gene:
 +
* [[RXN-8975]]
 +
** 1 associated gene(s):
 +
*** [[Ec-07_007020]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6459 PWY-6459]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6459 PWY-6459]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11065 RXN-11065]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11291 RXN-11291]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11339 RXN-11339]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15521 RXN-15521]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8976 RXN-8976]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-201174}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928]
+
{{#set: taxonomic range=TAX-1239}}
{{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=peptidoglycan biosynthesis II (staphylococci)}}
{{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}}
+
{{#set: reaction found=2}}
{{#set: common name=β-ketovaleryl-CoA}}
+
{{#set: total reaction=10}}
{{#set: molecular weight=861.604    }}
+
{{#set: completion rate=20.0}}
{{#set: consumed or produced by=RXN-12561}}
+

Latest revision as of 19:19, 21 March 2018

Pathway PWY-5265

  • taxonomic range:
  • common name:
    • peptidoglycan biosynthesis II (staphylococci)
  • Synonym(s):

Reaction(s) found

2 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links