Difference between revisions of "Ec-26 004980"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
 
(Created page with "Category:Gene == Gene Ec-26_004980 == * left end position: ** 5129190 * transcription direction: ** NEGATIVE * right end position: ** 5134364 * centisome position: ** 77.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Gene Ec-26_004980 ==
−
* smiles:
+
* left end position:
−
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** 5129190
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 15,16-dihydrobiliverdin
+
** 5134364
−
* molecular weight:
+
* centisome position:
−
** 582.655    
+
** 77.911575    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0103_0062
 +
** Esi0103_0062
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.3.7.3-RXN]]
+
* Reaction: [[RXN0-5144]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5129190}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=5134364}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
{{#set: centisome position=77.911575    }}
−
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: common name=Esi_0103_0062|Esi0103_0062}}
−
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
{{#set: reaction associated=RXN0-5144}}
−
{{#set: common name=15,16-dihydrobiliverdin}}
+
−
{{#set: molecular weight=582.655    }}
+
−
{{#set: consumed by=1.3.7.3-RXN}}
+

Latest revision as of 19:20, 21 March 2018

Gene Ec-26_004980

  • left end position:
    • 5129190
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5134364
  • centisome position:
    • 77.911575
  • Synonym(s):
    • Esi_0103_0062
    • Esi0103_0062

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_004980&oldid=26170"