Difference between revisions of "D-GALACTONO-1-4-LACTONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-12_008850 == * left end position: ** 7932674 * transcription direction: ** NEGATIVE * right end position: ** 7933338 * centisome position: ** 95.1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-12_008850 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
−
* left end position:
+
* smiles:
−
** 7932674
+
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
−
* right end position:
+
* common name:
−
** 7933338
+
** D-galactono-1,4-lactone
−
* centisome position:
+
* molecular weight:
−
** 95.16104    
+
** 178.141    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0067_0050
+
** D-galactonate-γ-lactone
−
** Esi0067_0050
+
** galactono-γ-lactone
 +
** D-galactonolactone
 +
** D-galactono-γ-lactone
 +
** D-galactonic acid γ-lactone
 +
** γ-D-galactonolactone
 +
** D-(-)-galactonic acid γ-lactone
 +
** D-galactonic acid g-lactone
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GDPPYPHOSKIN-RXN]]
+
* [[GALACTONOLACTONASE-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[GTPPYPHOSKIN-RXN]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PPGPPMET-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7932674}}
+
* CAS : 2782-07-2
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=7933338}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
−
{{#set: centisome position=95.16104   }}
+
* HMDB : HMDB02541
−
{{#set: common name=Esi_0067_0050|Esi0067_0050}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=GDPPYPHOSKIN-RXN|GTPPYPHOSKIN-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
−
{{#set: pathway associated=PPGPPMET-PWY}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
 +
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
 +
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
 +
{{#set: common name=D-galactono-1,4-lactone}}
 +
{{#set: molecular weight=178.141   }}
 +
{{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}}
 +
{{#set: consumed by=GALACTONOLACTONASE-RXN}}

Latest revision as of 20:20, 21 March 2018

Metabolite D-GALACTONO-1-4-LACTONE

  • smiles:
    • C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
  • inchi key:
    • InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
  • common name:
    • D-galactono-1,4-lactone
  • molecular weight:
    • 178.141
  • Synonym(s):
    • D-galactonate-γ-lactone
    • galactono-γ-lactone
    • D-galactonolactone
    • D-galactono-γ-lactone
    • D-galactonic acid γ-lactone
    • γ-D-galactonolactone
    • D-(-)-galactonic acid γ-lactone
    • D-galactonic acid g-lactone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=D-GALACTONO-1-4-LACTONE&oldid=26226"