Difference between revisions of "THR"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12699 CPD-12699] == * smiles: ** CCC(C)(O)C#N * inchi key: ** InChIKey=VMEHOTODTPXCKT-YFKPB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == * smiles: ** CC(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLD...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(O)C([N+])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-threonine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 119.12 |
* Synonym(s): | * Synonym(s): | ||
| + | ** T | ||
| + | ** thr | ||
| + | ** thre | ||
| + | ** L-thr | ||
| + | ** threonine | ||
| + | ** 2-amino-3-hydroxybutyric acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[biomass_rxn]] | ||
| + | * [[THREONINE--TRNA-LIGASE-RXN]] | ||
| + | * [[THREDEHYD-RXN]] | ||
| + | * [[THREONINE-ALDOLASE-RXN]] | ||
| + | * [[RXN-15122]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[THRESYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14569]] | ||
== External links == | == External links == | ||
| + | * CAS : 72-19-5 | ||
| + | * BIGG : 34186 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971019 6971019] |
| − | {{#set: smiles= | + | * HMDB : HMDB00167 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00188 C00188] |
| − | {{#set: molecular weight= | + | * CHEBI: |
| − | {{#set: produced by=RXN- | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57926 57926] |
| + | * METABOLIGHTS : MTBLC57926 | ||
| + | {{#set: smiles=CC(O)C([N+])C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N}} | ||
| + | {{#set: common name=L-threonine}} | ||
| + | {{#set: molecular weight=119.12 }} | ||
| + | {{#set: common name=T|thr|thre|L-thr|threonine|2-amino-3-hydroxybutyric acid}} | ||
| + | {{#set: consumed by=biomass_rxn|THREONINE--TRNA-LIGASE-RXN|THREDEHYD-RXN|THREONINE-ALDOLASE-RXN|RXN-15122}} | ||
| + | {{#set: produced by=THRESYN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-14569}} | ||
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite THR
- smiles:
- CC(O)C([N+])C(=O)[O-]
- inchi key:
- InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N
- common name:
- L-threonine
- molecular weight:
- 119.12
- Synonym(s):
- T
- thr
- thre
- L-thr
- threonine
- 2-amino-3-hydroxybutyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 72-19-5
- BIGG : 34186
- PUBCHEM:
- HMDB : HMDB00167
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57926
"CC(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
