Difference between revisions of "CPD-10332"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_005210 == * left end position: ** 4815771 * transcription direction: ** NEGATIVE * right end position: ** 4824649 * centisome position: ** 57.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L |
− | * | + | * common name: |
− | ** | + | ** gibberellin44 (open lactone form) |
− | * | + | * molecular weight: |
− | ** | + | ** 362.422 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** gibberellin A44 open lactone |
− | ** | + | ** gibberellin A44 diacid |
+ | ** GA44 open lactone | ||
+ | ** GA44 (open lactone form) | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN1F-168]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN1F-167]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPR0104170008 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095] | ||
+ | {{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
+ | {{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}} | ||
+ | {{#set: common name=gibberellin44 (open lactone form)}} | ||
+ | {{#set: molecular weight=362.422 }} | ||
+ | {{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}} | ||
+ | {{#set: consumed by=RXN1F-168}} | ||
+ | {{#set: produced by=RXN1F-167}} |
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-10332
- smiles:
- C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
- common name:
- gibberellin44 (open lactone form)
- molecular weight:
- 362.422
- Synonym(s):
- gibberellin A44 open lactone
- gibberellin A44 diacid
- GA44 open lactone
- GA44 (open lactone form)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.