Difference between revisions of "CPD-10332"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-12_005210 == * left end position: ** 4815771 * transcription direction: ** NEGATIVE * right end position: ** 4824649 * centisome position: ** 57.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-12_005210 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
* left end position:
+
* smiles:
** 4815771
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
* right end position:
+
* common name:
** 4824649
+
** gibberellin44 (open lactone form)
* centisome position:
+
* molecular weight:
** 57.77041    
+
** 362.422    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0444_0009
+
** gibberellin A44 open lactone
** Esi0444_0009
+
** gibberellin A44 diacid
 +
** GA44 open lactone
 +
** GA44 (open lactone form)
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ARYLSULFAT-RXN]]
+
* [[RXN1F-168]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***go-term
+
* [[RXN1F-167]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=4815771}}
+
* LIPID_MAPS : LMPR0104170008
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=4824649}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
{{#set: centisome position=57.77041   }}
+
* CHEBI:
{{#set: common name=Esi_0444_0009|Esi0444_0009}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
{{#set: reaction associated=ARYLSULFAT-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
 +
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
 +
{{#set: common name=gibberellin44 (open lactone form)}}
 +
{{#set: molecular weight=362.422   }}
 +
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
 +
{{#set: consumed by=RXN1F-168}}
 +
{{#set: produced by=RXN1F-167}}

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-10332

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
  • common name:
    • gibberellin44 (open lactone form)
  • molecular weight:
    • 362.422
  • Synonym(s):
    • gibberellin A44 open lactone
    • gibberellin A44 diacid
    • GA44 open lactone
    • GA44 (open lactone form)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.