Difference between revisions of "PWY-6133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6133 PWY-6133] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6133 PWY-6133] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-reticuline biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''7''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-5861]] |
| − | * [ | + | ** 2 associated gene(s): |
| + | *** [[Ec-12_008160]] | ||
| + | *** [[Ec-03_003140]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[TYROSINE-DECARBOXYLASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-14_004250]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.6.1.49-RXN 2.6.1.49-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9978 RXN-9978] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9979 RXN-9979] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9980 RXN-9980] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9981 RXN-9981] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-40674}} | |
| − | + | {{#set: common name=(S)-reticuline biosynthesis II}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=7}} | |
| − | {{#set: | + | {{#set: completion rate=29.0}} |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:21, 21 March 2018
Pathway PWY-6133
- taxonomic range:
- common name:
- (S)-reticuline biosynthesis II
- Synonym(s):
Reaction(s) found
2 reactions found over 7 reactions in the full pathway
- RXN-5861
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- TYROSINE-DECARBOXYLASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
