Difference between revisions of "PWY-6269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == * smiles: ** C(NC(N)=[N+])CCC(=O)N * inchi key: *...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] ==
−
* smiles:
+
* taxonomic range:
−
** C(NC(N)=[N+])CCC(=O)N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
−
** 4-guanidinobutyramide
+
** adenosylcobalamin salvage from cobinamide II
−
* molecular weight:
+
−
** 145.184   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-guanidinobutanamide
+
** vitamin B12 biosynthesis
−
** 4-guanidobutanamide
+
−
** 4-guanido-butyramide
+
−
** γ-guanidinobutyramide
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
+
'''1''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[BTUR2-RXN]]
−
* [[ARGININE-2-MONOOXYGENASE-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-06_010830]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R346-RXN R346-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8770 RXN-8770]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEBI:
+
{{#set: common name=adenosylcobalamin salvage from cobinamide II}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365]
+
{{#set: common name=vitamin B12 biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078]
+
{{#set: total reaction=7}}
−
{{#set: smiles=C(NC(N)=[N+])CCC(=O)N}}
+
{{#set: completion rate=14.0}}
−
{{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}}
+
−
{{#set: common name=4-guanidinobutyramide}}
+
−
{{#set: molecular weight=145.184    }}
+
−
{{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}}
+
−
{{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}}
+
−
{{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}}
+

Latest revision as of 19:21, 21 March 2018

Pathway PWY-6269

  • taxonomic range:
  • common name:
    • adenosylcobalamin salvage from cobinamide II
  • Synonym(s):
    • vitamin B12 biosynthesis

Reaction(s) found

1 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6269&oldid=26360"