Difference between revisions of "Ec-08 000940"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
(Created page with "Category:Gene == Gene Ec-08_000940 == * left end position: ** 958939 * transcription direction: ** POSITIVE * right end position: ** 967385 * centisome position: ** 14.318...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Gene Ec-08_000940 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** 958939
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
** 967385
−
* molecular weight:
+
* centisome position:
−
** 442.724    
+
** 14.318792    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0214_0046
 +
** Esi0214_0046
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-13]]
+
* Reaction: [[4.2.2.10-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN66-12]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14897]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7243]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=958939}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203343 25203343]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB12159
+
{{#set: right end position=967385}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: centisome position=14.318792    }}
−
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: common name=Esi_0214_0046|Esi0214_0046}}
−
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: reaction associated=4.2.2.10-RXN|RXN-14897}}
−
{{#set: molecular weight=442.724    }}
+
{{#set: pathway associated=PWY-7243}}
−
{{#set: consumed by=RXN66-13}}
+
−
{{#set: produced by=RXN66-12}}
+

Latest revision as of 19:21, 21 March 2018

Gene Ec-08_000940

  • left end position:
    • 958939
  • transcription direction:
    • POSITIVE
  • right end position:
    • 967385
  • centisome position:
    • 14.318792
  • Synonym(s):
    • Esi_0214_0046
    • Esi0214_0046

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_000940&oldid=26368"